About CID 157248991
CID 157248991 (PubChem CID 157248991) has the molecular formula C40H31B9F2O11S
and a molecular weight of 855.05 g/mol.
Molecular Properties
| Compound Name | CID 157248991 |
| PubChem CID | 157248991 |
| Molecular Formula | C40H31B9F2O11S |
| Molecular Weight | 855.05 g/mol |
| Exact Mass | 856.24 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C[B])c(OC(=O)c2cc(C(=O)Oc3c(C[B])cc(C[B])cc3C[B])c(C(=O)OC(C)C(F)(F)S(=O)(=O)O)cc2C(=O)Oc2c(C[B])cc(C[B])cc2C[B])c(C[B])c1 |
| InChI | InChI=1S/C40H31B9F2O11S/c1-19(40(50,51)63(56,57)58)59-36(52)29-8-31(38(54)61-34-25(15-46)4-21(11-42)5-26(34)16-47)32(39(55)62-35-27(17-48)6-22(12-43)7-28(35)18-49)9-30(29)37(53)60-33-23(13-44)2-20(10-41)3-24(33)14-45/h2-9,19H,10-18H2,1H3,(H,56,57,58) |
| InChIKey | KNTRUQOETZHCAY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 855.05 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 157248991 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157248991?
The IUPAC name of CID 157248991 (CID 157248991) is not available.
What is the SMILES notation for CID 157248991?
The canonical SMILES for CID 157248991 is [B]Cc1cc(C[B])c(OC(=O)c2cc(C(=O)Oc3c(C[B])cc(C[B])cc3C[B])c(C(=O)OC(C)C(F)(F)S(=O)(=O)O)cc2C(=O)Oc2c(C[B])cc(C[B])cc2C[B])c(C[B])c1.
What is the InChIKey of CID 157248991?
The InChIKey is KNTRUQOETZHCAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H31B9F2O11S/c1-19(40(50,51)63(56,57)58)59-36(52)29-8-31(38(54)61-34-25(15-46)4-21(11-42)5-26(34)16-47)32(39(55)62-35-27(17-48)6-22(12-43)7-28(35)18-49)9-30(29)37(53)60-33-23(13-44)2-20(10-41)3-24(33)14-45/h2-9,19H,10-18H2,1H3,(H,56,57,58).
What are the key properties of CID 157248991?
CID 157248991 has a molecular weight of 855.05 g/mol, XLogP of 2.39, 19 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157248991 is sourced from PubChem (CID 157248991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).