C22H25BrFIN6O3S — CID 157249506
tert-butyl (2S,4S)-2-(2-amino-2-oxoethyl)-4-(7-bromo-6-fluoro-8-iodo-4-methylsulfanyltriazolo[4,5-c]quinolin-1-yl)piperidine-1-carboxylate (PubChem CID 157249506) has the molecular formula C22H25BrFIN6O3S and a molecular weight of 679.35 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-(2-amino-2-oxoethyl)-4-(7-bromo-6-fluoro-8-iodo-4-methylsulfanyltriazolo[4,5-c]quinolin-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-(2-amino-2-oxoethyl)-4-(7-bromo-6-fluoro-8-iodo-4-methylsulfanyltriazolo[4,5-c]quinolin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 157249506 |
| Molecular Formula | C22H25BrFIN6O3S |
| Molecular Weight | 679.35 g/mol |
| Exact Mass | 677.99 |
| IUPAC Name | tert-butyl (2S,4S)-2-(2-amino-2-oxoethyl)-4-(7-bromo-6-fluoro-8-iodo-4-methylsulfanyltriazolo[4,5-c]quinolin-1-yl)piperidine-1-carboxylate |
| SMILES | CSc1nc2c(F)c(Br)c(I)cc2c2c1nnn2[C@H]1CCN(C(=O)OC(C)(C)C)[C@H](CC(N)=O)C1 |
| InChI | InChI=1S/C22H25BrFIN6O3S/c1-22(2,3)34-21(33)30-6-5-10(7-11(30)8-14(26)32)31-19-12-9-13(25)15(23)16(24)17(12)27-20(35-4)18(19)28-29-31/h9-11H,5-8H2,1-4H3,(H2,26,32)/t10-,11-/m0/s1 |
| InChIKey | AWEFSZHDYYFJDD-QWRGUYRKSA-N |
| XLogP | 5.02 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|