C36H22F2N6 — CID 157251104
2-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 157251104) has the molecular formula C36H22F2N6 and a molecular weight of 576.61 g/mol. Its IUPAC name is 2-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 157251104 |
| Molecular Formula | C36H22F2N6 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | 2-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Fc1ccc(-c2nc(-c3ccc(F)cc3)nc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)n2)cc1 |
| InChI | InChI=1S/C36H22F2N6/c37-29-19-15-27(16-20-29)35-42-34(43-36(44-35)28-17-21-30(38)22-18-28)26-13-11-25(12-14-26)33-40-31(23-7-3-1-4-8-23)39-32(41-33)24-9-5-2-6-10-24/h1-22H |
| InChIKey | XRXQJLCHFGSQKC-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |