C34H48O6 — CID 157251486
[2,4-bis(4-methoxyphenyl)-3-(2-methylheptanoyloxy)cyclobutyl] 2-methylheptanoate (PubChem CID 157251486) has the molecular formula C34H48O6 and a molecular weight of 552.75 g/mol. Its IUPAC name is [2,4-bis(4-methoxyphenyl)-3-(2-methylheptanoyloxy)cyclobutyl] 2-methylheptanoate.
| Compound Name | [2,4-bis(4-methoxyphenyl)-3-(2-methylheptanoyloxy)cyclobutyl] 2-methylheptanoate |
|---|---|
| PubChem CID | 157251486 |
| Molecular Formula | C34H48O6 |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | [2,4-bis(4-methoxyphenyl)-3-(2-methylheptanoyloxy)cyclobutyl] 2-methylheptanoate |
| SMILES | CCCCCC(C)C(=O)OC1C(c2ccc(OC)cc2)C(OC(=O)C(C)CCCCC)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C34H48O6/c1-7-9-11-13-23(3)33(35)39-31-29(25-15-19-27(37-5)20-16-25)32(40-34(36)24(4)14-12-10-8-2)30(31)26-17-21-28(38-6)22-18-26/h15-24,29-32H,7-14H2,1-6H3 |
| InChIKey | NHGMOWLKIJIPFK-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|