C22H25N — CID 157252538
5-methyl-2-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]pyridine (PubChem CID 157252538) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is 5-methyl-2-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]pyridine.
| Compound Name | 5-methyl-2-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]pyridine |
|---|---|
| PubChem CID | 157252538 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 5-methyl-2-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]pyridine |
| SMILES | Cc1ccc(C#Cc2ccc3c(c2)C(C)(C)CCC3(C)C)nc1 |
| InChI | InChI=1S/C22H25N/c1-16-6-9-18(23-15-16)10-7-17-8-11-19-20(14-17)22(4,5)13-12-21(19,2)3/h6,8-9,11,14-15H,12-13H2,1-5H3 |
| InChIKey | OEIUSDOKDUAJKT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|