About 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride
3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride (PubChem CID 15725414) has the molecular formula C9H7ClN4O2S
and a molecular weight of 270.70 g/mol. Its IUPAC name is 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride |
| PubChem CID | 15725414 |
| Molecular Formula | C9H7ClN4O2S |
| Molecular Weight | 270.70 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride |
| SMILES | Cc1cc(C)n2nc(S(=O)(=O)Cl)c(C#N)c2n1 |
| InChI | InChI=1S/C9H7ClN4O2S/c1-5-3-6(2)14-8(12-5)7(4-11)9(13-14)17(10,15)16/h3H,1-2H3 |
| InChIKey | MNDZFAPFIUIKPL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.70 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride?
The IUPAC name of 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride (CID 15725414) is 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride.
What is the SMILES notation for 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride?
The canonical SMILES for 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride is Cc1cc(C)n2nc(S(=O)(=O)Cl)c(C#N)c2n1.
What is the InChIKey of 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride?
The InChIKey is MNDZFAPFIUIKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN4O2S/c1-5-3-6(2)14-8(12-5)7(4-11)9(13-14)17(10,15)16/h3H,1-2H3.
What are the key properties of 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride?
3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride has a molecular weight of 270.70 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-sulfonyl chloride is sourced from PubChem (CID 15725414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).