C47H27N3O2 — CID 157255217
2-[3-[3-(8-isocyanodibenzofuran-4-yl)phenyl]phenyl]-4-(3-phenylphenyl)-[1]benzofuro[2,3-d]pyrimidine (PubChem CID 157255217) has the molecular formula C47H27N3O2 and a molecular weight of 665.75 g/mol. Its IUPAC name is 2-[3-[3-(8-isocyanodibenzofuran-4-yl)phenyl]phenyl]-4-(3-phenylphenyl)-[1]benzofuro[2,3-d]pyrimidine.
| Compound Name | 2-[3-[3-(8-isocyanodibenzofuran-4-yl)phenyl]phenyl]-4-(3-phenylphenyl)-[1]benzofuro[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 157255217 |
| Molecular Formula | C47H27N3O2 |
| Molecular Weight | 665.75 g/mol |
| Exact Mass | 665.21 |
| IUPAC Name | 2-[3-[3-(8-isocyanodibenzofuran-4-yl)phenyl]phenyl]-4-(3-phenylphenyl)-[1]benzofuro[2,3-d]pyrimidine |
| SMILES | [C-]#[N+]c1ccc2oc3c(-c4cccc(-c5cccc(-c6nc(-c7cccc(-c8ccccc8)c7)c7c(n6)oc6ccccc67)c5)c4)cccc3c2c1 |
| InChI | InChI=1S/C47H27N3O2/c1-48-36-23-24-42-40(28-36)38-21-10-20-37(45(38)51-42)33-16-7-14-31(25-33)32-15-9-18-35(27-32)46-49-44(43-39-19-5-6-22-41(39)52-47(43)50-46)34-17-8-13-30(26-34)29-11-3-2-4-12-29/h2-28H |
| InChIKey | RCDHRBHRYYOQTR-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 56.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.75 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|