About 3,4-bis(prop-1-enoxy)oxolane;oxetane
3,4-bis(prop-1-enoxy)oxolane;oxetane (PubChem CID 157255873) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is 3,4-bis(prop-1-enoxy)oxolane;oxetane.
Molecular Properties
| Compound Name | 3,4-bis(prop-1-enoxy)oxolane;oxetane |
| PubChem CID | 157255873 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3,4-bis(prop-1-enoxy)oxolane;oxetane |
| SMILES | C1COC1.CC=COC1COCC1OC=CC |
| InChI | InChI=1S/C10H16O3.C3H6O/c1-3-5-12-9-7-11-8-10(9)13-6-4-2;1-2-4-3-1/h3-6,9-10H,7-8H2,1-2H3;1-3H2 |
| InChIKey | AWWQBWIRVZXKHI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(prop-1-enoxy)oxolane;oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(prop-1-enoxy)oxolane;oxetane?
The IUPAC name of 3,4-bis(prop-1-enoxy)oxolane;oxetane (CID 157255873) is 3,4-bis(prop-1-enoxy)oxolane;oxetane.
What is the SMILES notation for 3,4-bis(prop-1-enoxy)oxolane;oxetane?
The canonical SMILES for 3,4-bis(prop-1-enoxy)oxolane;oxetane is C1COC1.CC=COC1COCC1OC=CC.
What is the InChIKey of 3,4-bis(prop-1-enoxy)oxolane;oxetane?
The InChIKey is AWWQBWIRVZXKHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3.C3H6O/c1-3-5-12-9-7-11-8-10(9)13-6-4-2;1-2-4-3-1/h3-6,9-10H,7-8H2,1-2H3;1-3H2.
What are the key properties of 3,4-bis(prop-1-enoxy)oxolane;oxetane?
3,4-bis(prop-1-enoxy)oxolane;oxetane has a molecular weight of 242.31 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(prop-1-enoxy)oxolane;oxetane is sourced from PubChem (CID 157255873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).