C14H14O3 — CID 15725638
2,5,9-trimethyl-5,6-dihydrofuro[3,2-g]chromen-7-one (PubChem CID 15725638) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2,5,9-trimethyl-5,6-dihydrofuro[3,2-g]chromen-7-one.
| Compound Name | 2,5,9-trimethyl-5,6-dihydrofuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 15725638 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2,5,9-trimethyl-5,6-dihydrofuro[3,2-g]chromen-7-one |
| SMILES | Cc1cc2cc3c(c(C)c2o1)OC(=O)CC3C |
| InChI | InChI=1S/C14H14O3/c1-7-4-12(15)17-14-9(3)13-10(6-11(7)14)5-8(2)16-13/h5-7H,4H2,1-3H3 |
| InChIKey | GKWGUOABELCTSZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|