C37H36F2N4 — CID 157256605
2-[(2S,4S)-4-fluoropyrrolidin-2-yl]-5-[3-[4-[2-[(2S,4S)-4-fluoropyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]-2,2a,7,7a-tetrahydro-1H-cyclobuta[a]inden-6-yl]-3H-indole (PubChem CID 157256605) has the molecular formula C37H36F2N4 and a molecular weight of 574.72 g/mol. Its IUPAC name is 2-[(2S,4S)-4-fluoropyrrolidin-2-yl]-5-[3-[4-[2-[(2S,4S)-4-fluoropyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]-2,2a,7,7a-tetrahydro-1H-cyclobuta[a]inden-6-yl]-3H-indole.
| Compound Name | 2-[(2S,4S)-4-fluoropyrrolidin-2-yl]-5-[3-[4-[2-[(2S,4S)-4-fluoropyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]-2,2a,7,7a-tetrahydro-1H-cyclobuta[a]inden-6-yl]-3H-indole |
|---|---|
| PubChem CID | 157256605 |
| Molecular Formula | C37H36F2N4 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 2-[(2S,4S)-4-fluoropyrrolidin-2-yl]-5-[3-[4-[2-[(2S,4S)-4-fluoropyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]-2,2a,7,7a-tetrahydro-1H-cyclobuta[a]inden-6-yl]-3H-indole |
| SMILES | F[C@@H]1CN[C@H](C2=NC=C(c3ccc(-c4ccc(-c5ccc6c(c5)CC([C@@H]5C[C@H](F)CN5)=N6)c5c4C4CCC4C5)cc3)C2)C1 |
| InChI | InChI=1S/C37H36F2N4/c38-26-15-34(41-18-26)33-14-25(17-40-33)20-1-3-21(4-2-20)29-9-8-28(31-12-23-5-7-30(23)37(29)31)22-6-10-32-24(11-22)13-36(43-32)35-16-27(39)19-42-35/h1-4,6,8-11,17,23,26-27,30,34-35,41-42H,5,7,12-16,18-19H2/t23?,26-,27-,30?,34-,35-/m0/s1 |
| InChIKey | VEBNGQDUALFVIV-NVRVAOSJSA-N |
| XLogP | 7.28 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |