C8H12O — CID 157257141
(4aR,7aS)-2,4a,5,6,7,7a-hexahydrocyclopenta[b]pyran (PubChem CID 157257141) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (4aR,7aS)-2,4a,5,6,7,7a-hexahydrocyclopenta[b]pyran.
| Compound Name | (4aR,7aS)-2,4a,5,6,7,7a-hexahydrocyclopenta[b]pyran |
|---|---|
| PubChem CID | 157257141 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (4aR,7aS)-2,4a,5,6,7,7a-hexahydrocyclopenta[b]pyran |
| SMILES | C1=C[C@H]2CCC[C@@H]2OC1 |
| InChI | InChI=1S/C8H12O/c1-3-7-4-2-6-9-8(7)5-1/h2,4,7-8H,1,3,5-6H2/t7-,8+/m1/s1 |
| InChIKey | ZIYCQSAFAAADBD-SFYZADRCSA-N |
| XLogP | 1.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|