About 10-(4,5-diphenylpyrazol-1-yl)decanoic acid
10-(4,5-diphenylpyrazol-1-yl)decanoic acid (PubChem CID 15725736) has the molecular formula C25H30N2O2
and a molecular weight of 390.53 g/mol. Its IUPAC name is 10-(4,5-diphenylpyrazol-1-yl)decanoic acid.
Molecular Properties
| Compound Name | 10-(4,5-diphenylpyrazol-1-yl)decanoic acid |
| PubChem CID | 15725736 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 10-(4,5-diphenylpyrazol-1-yl)decanoic acid |
| SMILES | O=C(O)CCCCCCCCCn1ncc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H30N2O2/c28-24(29)18-12-4-2-1-3-5-13-19-27-25(22-16-10-7-11-17-22)23(20-26-27)21-14-8-6-9-15-21/h6-11,14-17,20H,1-5,12-13,18-19H2,(H,28,29) |
| InChIKey | ACRFLRNCJOXGIT-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-(4,5-diphenylpyrazol-1-yl)decanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(4,5-diphenylpyrazol-1-yl)decanoic acid?
The IUPAC name of 10-(4,5-diphenylpyrazol-1-yl)decanoic acid (CID 15725736) is 10-(4,5-diphenylpyrazol-1-yl)decanoic acid.
What is the SMILES notation for 10-(4,5-diphenylpyrazol-1-yl)decanoic acid?
The canonical SMILES for 10-(4,5-diphenylpyrazol-1-yl)decanoic acid is O=C(O)CCCCCCCCCn1ncc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 10-(4,5-diphenylpyrazol-1-yl)decanoic acid?
The InChIKey is ACRFLRNCJOXGIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2O2/c28-24(29)18-12-4-2-1-3-5-13-19-27-25(22-16-10-7-11-17-22)23(20-26-27)21-14-8-6-9-15-21/h6-11,14-17,20H,1-5,12-13,18-19H2,(H,28,29).
What are the key properties of 10-(4,5-diphenylpyrazol-1-yl)decanoic acid?
10-(4,5-diphenylpyrazol-1-yl)decanoic acid has a molecular weight of 390.53 g/mol, XLogP of 6.42, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(4,5-diphenylpyrazol-1-yl)decanoic acid is sourced from PubChem (CID 15725736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).