About tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate
tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate (PubChem CID 15725739) has the molecular formula C33H38N2O3
and a molecular weight of 510.68 g/mol. Its IUPAC name is tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate |
| PubChem CID | 15725739 |
| Molecular Formula | C33H38N2O3 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCCCCCn1nc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C33H38N2O3/c1-33(2,3)38-29(36)25-37-24-16-5-4-15-23-35-32(28-21-13-8-14-22-28)30(26-17-9-6-10-18-26)31(34-35)27-19-11-7-12-20-27/h6-14,17-22H,4-5,15-16,23-25H2,1-3H3 |
| InChIKey | YYWFVYOJBKDCRV-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate?
The IUPAC name of tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate (CID 15725739) is tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate.
What is the SMILES notation for tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate?
The canonical SMILES for tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate is CC(C)(C)OC(=O)COCCCCCCn1nc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate?
The InChIKey is YYWFVYOJBKDCRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H38N2O3/c1-33(2,3)38-29(36)25-37-24-16-5-4-15-23-35-32(28-21-13-8-14-22-28)30(26-17-9-6-10-18-26)31(34-35)27-19-11-7-12-20-27/h6-14,17-22H,4-5,15-16,23-25H2,1-3H3.
What are the key properties of tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate?
tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate has a molecular weight of 510.68 g/mol, XLogP of 7.80, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]acetate is sourced from PubChem (CID 15725739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).