C26H27N3O6S — CID 157260227
4-[(4aR,10bR)-9-ethoxy-8-methoxy-3,4,4a,10b-tetrahydro-1H-thiopyrano[4,3-c]isoquinolin-6-yl]benzoic acid;1H-pyrimidine-2,4-dione (PubChem CID 157260227) has the molecular formula C26H27N3O6S and a molecular weight of 509.58 g/mol. Its IUPAC name is 4-[(4aR,10bR)-9-ethoxy-8-methoxy-3,4,4a,10b-tetrahydro-1H-thiopyrano[4,3-c]isoquinolin-6-yl]benzoic acid;1H-pyrimidine-2,4-dione.
| Compound Name | 4-[(4aR,10bR)-9-ethoxy-8-methoxy-3,4,4a,10b-tetrahydro-1H-thiopyrano[4,3-c]isoquinolin-6-yl]benzoic acid;1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 157260227 |
| Molecular Formula | C26H27N3O6S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 4-[(4aR,10bR)-9-ethoxy-8-methoxy-3,4,4a,10b-tetrahydro-1H-thiopyrano[4,3-c]isoquinolin-6-yl]benzoic acid;1H-pyrimidine-2,4-dione |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(C(=O)O)cc1)=N[C@@H]1CCSC[C@H]21.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C22H23NO4S.C4H4N2O2/c1-3-27-20-10-15-16(11-19(20)26-2)21(23-18-8-9-28-12-17(15)18)13-4-6-14(7-5-13)22(24)25;7-3-1-2-5-4(8)6-3/h4-7,10-11,17-18H,3,8-9,12H2,1-2H3,(H,24,25);1-2H,(H2,5,6,7,8)/t17-,18-;/m1./s1 |
| InChIKey | AXJFGWFWFUTLIY-JAXOOIEVSA-N |
| XLogP | 3.30 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |