About methanimine;octane-3,6-dione;pyrrole-2,5-dione
methanimine;octane-3,6-dione;pyrrole-2,5-dione (PubChem CID 157260836) has the molecular formula C13H20N2O4
and a molecular weight of 268.31 g/mol. Its IUPAC name is methanimine;octane-3,6-dione;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | methanimine;octane-3,6-dione;pyrrole-2,5-dione |
| PubChem CID | 157260836 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | methanimine;octane-3,6-dione;pyrrole-2,5-dione |
| SMILES | CCC(=O)CCC(=O)CC.O=C1C=CC(=O)N1.[H]N=C |
| InChI | InChI=1S/C8H14O2.C4H3NO2.CH3N/c1-3-7(9)5-6-8(10)4-2;6-3-1-2-4(7)5-3;1-2/h3-6H2,1-2H3;1-2H,(H,5,6,7);2H,1H2 |
| InChIKey | AXKYYXDQVLEFEI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methanimine;octane-3,6-dione;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanimine;octane-3,6-dione;pyrrole-2,5-dione?
The IUPAC name of methanimine;octane-3,6-dione;pyrrole-2,5-dione (CID 157260836) is methanimine;octane-3,6-dione;pyrrole-2,5-dione.
What is the SMILES notation for methanimine;octane-3,6-dione;pyrrole-2,5-dione?
The canonical SMILES for methanimine;octane-3,6-dione;pyrrole-2,5-dione is CCC(=O)CCC(=O)CC.O=C1C=CC(=O)N1.[H]N=C.
What is the InChIKey of methanimine;octane-3,6-dione;pyrrole-2,5-dione?
The InChIKey is AXKYYXDQVLEFEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C4H3NO2.CH3N/c1-3-7(9)5-6-8(10)4-2;6-3-1-2-4(7)5-3;1-2/h3-6H2,1-2H3;1-2H,(H,5,6,7);2H,1H2.
What are the key properties of methanimine;octane-3,6-dione;pyrrole-2,5-dione?
methanimine;octane-3,6-dione;pyrrole-2,5-dione has a molecular weight of 268.31 g/mol, XLogP of 1.19, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanimine;octane-3,6-dione;pyrrole-2,5-dione is sourced from PubChem (CID 157260836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).