About CID 157261137
CID 157261137 (PubChem CID 157261137) has the molecular formula C20H18B3F3O11S2
and a molecular weight of 587.92 g/mol.
Molecular Properties
| Compound Name | CID 157261137 |
| PubChem CID | 157261137 |
| Molecular Formula | C20H18B3F3O11S2 |
| Molecular Weight | 587.92 g/mol |
| Exact Mass | 588.05 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C[B])c(C[B])c(C(=O)OC2C3OS(=O)(=O)C4C3OC2C4C(=O)OC(CS(=O)(=O)O)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18B3F3O11S2/c21-3-7-1-8(4-22)10(5-23)9(2-7)18(27)36-14-13-12(17-16(35-13)15(14)37-39(17,32)33)19(28)34-11(20(24,25)26)6-38(29,30)31/h1-2,11-17H,3-6H2,(H,29,30,31) |
| InChIKey | UDCOGPKMTGVERI-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 587.92 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 157261137 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157261137?
The IUPAC name of CID 157261137 (CID 157261137) is not available.
What is the SMILES notation for CID 157261137?
The canonical SMILES for CID 157261137 is [B]Cc1cc(C[B])c(C[B])c(C(=O)OC2C3OS(=O)(=O)C4C3OC2C4C(=O)OC(CS(=O)(=O)O)C(F)(F)F)c1.
What is the InChIKey of CID 157261137?
The InChIKey is UDCOGPKMTGVERI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18B3F3O11S2/c21-3-7-1-8(4-22)10(5-23)9(2-7)18(27)36-14-13-12(17-16(35-13)15(14)37-39(17,32)33)19(28)34-11(20(24,25)26)6-38(29,30)31/h1-2,11-17H,3-6H2,(H,29,30,31).
What are the key properties of CID 157261137?
CID 157261137 has a molecular weight of 587.92 g/mol, XLogP of -0.93, 9 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157261137 is sourced from PubChem (CID 157261137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).