C25H48N4O6 — CID 157261220
bis(tert-butyl 4-propanoylpiperazine-1-carboxylate);methane (PubChem CID 157261220) has the molecular formula C25H48N4O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is bis(tert-butyl 4-propanoylpiperazine-1-carboxylate);methane.
| Compound Name | bis(tert-butyl 4-propanoylpiperazine-1-carboxylate);methane |
|---|---|
| PubChem CID | 157261220 |
| Molecular Formula | C25H48N4O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.36 |
| IUPAC Name | bis(tert-butyl 4-propanoylpiperazine-1-carboxylate);methane |
| SMILES | C.CCC(=O)N1CCN(C(=O)OC(C)(C)C)CC1.CCC(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/2C12H22N2O3.CH4/c2*1-5-10(15)13-6-8-14(9-7-13)11(16)17-12(2,3)4;/h2*5-9H2,1-4H3;1H4 |
| InChIKey | AXMCQZLYBZRQTP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |