C16H31IO4Si — CID 157261517
1-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-iodoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-one (PubChem CID 157261517) has the molecular formula C16H31IO4Si and a molecular weight of 442.41 g/mol. Its IUPAC name is 1-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-iodoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-one.
| Compound Name | 1-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-iodoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 157261517 |
| Molecular Formula | C16H31IO4Si |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 1-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-iodoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-one |
| SMILES | CCC(=O)[C@H]1OC(C)(C)O[C@H]1[C@@H](CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31IO4Si/c1-9-11(18)13-14(20-16(5,6)19-13)12(10-17)21-22(7,8)15(2,3)4/h12-14H,9-10H2,1-8H3/t12-,13-,14+/m1/s1 |
| InChIKey | AWCHJDXPXMSCCQ-MCIONIFRSA-N |
| XLogP | 4.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|