C15H21F9O2 — CID 157261606
(Z)-3-ethyl-1,1,1,9,9,9-hexafluoro-4,6-dimethoxy-7-(2,2,2-trifluoroethyl)non-4-ene (PubChem CID 157261606) has the molecular formula C15H21F9O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is (Z)-3-ethyl-1,1,1,9,9,9-hexafluoro-4,6-dimethoxy-7-(2,2,2-trifluoroethyl)non-4-ene.
| Compound Name | (Z)-3-ethyl-1,1,1,9,9,9-hexafluoro-4,6-dimethoxy-7-(2,2,2-trifluoroethyl)non-4-ene |
|---|---|
| PubChem CID | 157261606 |
| Molecular Formula | C15H21F9O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (Z)-3-ethyl-1,1,1,9,9,9-hexafluoro-4,6-dimethoxy-7-(2,2,2-trifluoroethyl)non-4-ene |
| SMILES | CCC(CC(F)(F)F)/C(=C/C(OC)C(CC(F)(F)F)CC(F)(F)F)OC |
| InChI | InChI=1S/C15H21F9O2/c1-4-9(6-13(16,17)18)11(25-2)5-12(26-3)10(7-14(19,20)21)8-15(22,23)24/h5,9-10,12H,4,6-8H2,1-3H3/b11-5- |
| InChIKey | QFSGTOLWWSQYTR-WZUFQYTHSA-N |
| XLogP | 6.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|