C26H14BBr3F12N2O2 — CID 157261951
[3,5-bis(trifluoromethyl)phenyl]boronic acid;2-[3,5-bis(trifluoromethyl)phenyl]-6-bromopyridine;2,6-dibromopyridine (PubChem CID 157261951) has the molecular formula C26H14BBr3F12N2O2 and a molecular weight of 864.91 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]boronic acid;2-[3,5-bis(trifluoromethyl)phenyl]-6-bromopyridine;2,6-dibromopyridine.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]boronic acid;2-[3,5-bis(trifluoromethyl)phenyl]-6-bromopyridine;2,6-dibromopyridine |
|---|---|
| PubChem CID | 157261951 |
| Molecular Formula | C26H14BBr3F12N2O2 |
| Molecular Weight | 864.91 g/mol |
| Exact Mass | 861.85 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]boronic acid;2-[3,5-bis(trifluoromethyl)phenyl]-6-bromopyridine;2,6-dibromopyridine |
| SMILES | Brc1cccc(Br)n1.FC(F)(F)c1cc(-c2cccc(Br)n2)cc(C(F)(F)F)c1.OB(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H6BrF6N.C8H5BF6O2.C5H3Br2N/c14-11-3-1-2-10(21-11)7-4-8(12(15,16)17)6-9(5-7)13(18,19)20;10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)9(16)17;6-4-2-1-3-5(7)8-4/h1-6H;1-3,16-17H;1-3H |
| InChIKey | AXOIFQFEGXKEOM-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.91 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|