C16H17NO — CID 157262745
5-isocyano-5-methyl-1,4,7,8,9,9a-hexahydrobenzo[f]azulen-2-one (PubChem CID 157262745) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-isocyano-5-methyl-1,4,7,8,9,9a-hexahydrobenzo[f]azulen-2-one.
| Compound Name | 5-isocyano-5-methyl-1,4,7,8,9,9a-hexahydrobenzo[f]azulen-2-one |
|---|---|
| PubChem CID | 157262745 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 5-isocyano-5-methyl-1,4,7,8,9,9a-hexahydrobenzo[f]azulen-2-one |
| SMILES | [C-]#[N+]C1(C)CC2=CC(=O)CC2=CC2CCCC=C21 |
| InChI | InChI=1S/C16H17NO/c1-16(17-2)10-13-9-14(18)8-12(13)7-11-5-3-4-6-15(11)16/h6-7,9,11H,3-5,8,10H2,1H3 |
| InChIKey | NIRPMCYWAKABTE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|