C31H38O5 — CID 15726289
(2R,3S,4R,5R,6R)-2-butyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 15726289) has the molecular formula C31H38O5 and a molecular weight of 490.64 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-butyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2R,3S,4R,5R,6R)-2-butyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 15726289 |
| Molecular Formula | C31H38O5 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-butyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CCCC[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C31H38O5/c1-2-3-19-27-29(32)31(35-22-26-17-11-6-12-18-26)30(34-21-25-15-9-5-10-16-25)28(36-27)23-33-20-24-13-7-4-8-14-24/h4-18,27-32H,2-3,19-23H2,1H3/t27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | KYLHDDCPLWULQT-PXPWAULYSA-N |
| XLogP | 5.69 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |