C29H34O5 — CID 15726291
(2R,3S,4R,5R,6R)-2-ethyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 15726291) has the molecular formula C29H34O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-ethyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2R,3S,4R,5R,6R)-2-ethyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 15726291 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-ethyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CC[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C29H34O5/c1-2-25-27(30)29(33-20-24-16-10-5-11-17-24)28(32-19-23-14-8-4-9-15-23)26(34-25)21-31-18-22-12-6-3-7-13-22/h3-17,25-30H,2,18-21H2,1H3/t25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | RORHYGHROQVTJE-XYPQWYOHSA-N |
| XLogP | 4.91 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |