C19H28O3 — CID 15726397
(6E,10E)-6,10-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-one (PubChem CID 15726397) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (6E,10E)-6,10-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-one.
| Compound Name | (6E,10E)-6,10-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-one |
|---|---|
| PubChem CID | 15726397 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (6E,10E)-6,10-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-one |
| SMILES | C#CC(=O)CC/C(C)=C/CC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C19H28O3/c1-4-18(20)12-11-16(2)8-7-9-17(3)13-15-22-19-10-5-6-14-21-19/h1,8,13,19H,5-7,9-12,14-15H2,2-3H3/b16-8+,17-13+ |
| InChIKey | YJCXMHKDAJIIFU-IUIJUMGXSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|