C21H22F2N4O2S — CID 157264195
N-[2-[[5-(1,1-difluoroethyl)-2-pyridinyl]amino]ethyl]-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide (PubChem CID 157264195) has the molecular formula C21H22F2N4O2S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[2-[[5-(1,1-difluoroethyl)-2-pyridinyl]amino]ethyl]-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide.
| Compound Name | N-[2-[[5-(1,1-difluoroethyl)-2-pyridinyl]amino]ethyl]-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 157264195 |
| Molecular Formula | C21H22F2N4O2S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[2-[[5-(1,1-difluoroethyl)-2-pyridinyl]amino]ethyl]-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide |
| SMILES | Cc1cc(CSc2ccccc2C(=O)NCCNc2ccc(C(C)(F)F)cn2)on1 |
| InChI | InChI=1S/C21H22F2N4O2S/c1-14-11-16(29-27-14)13-30-18-6-4-3-5-17(18)20(28)25-10-9-24-19-8-7-15(12-26-19)21(2,22)23/h3-8,11-12H,9-10,13H2,1-2H3,(H,24,26)(H,25,28) |
| InChIKey | MBSXJSGBCVGFRP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|