C32H40O10 — CID 157264569
[(4S,9S,10R)-4,12-diacetyloxy-1,15-dihydroxy-9,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 157264569) has the molecular formula C32H40O10 and a molecular weight of 584.66 g/mol. Its IUPAC name is [(4S,9S,10R)-4,12-diacetyloxy-1,15-dihydroxy-9,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(4S,9S,10R)-4,12-diacetyloxy-1,15-dihydroxy-9,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 157264569 |
| Molecular Formula | C32H40O10 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | [(4S,9S,10R)-4,12-diacetyloxy-1,15-dihydroxy-9,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC(=O)OC1C(=O)[C@@]2(C)C(C(OC(=O)c3ccccc3)C3(O)CC(O)C(C)=C1C3(C)C)[C@]1(OC(C)=O)COC1C[C@@H]2C |
| InChI | InChI=1S/C32H40O10/c1-16-13-22-31(15-39-22,42-19(4)34)25-27(41-28(37)20-11-9-8-10-12-20)32(38)14-21(35)17(2)23(29(32,5)6)24(40-18(3)33)26(36)30(16,25)7/h8-12,16,21-22,24-25,27,35,38H,13-15H2,1-7H3/t16-,21?,22?,24?,25?,27?,30+,31-,32?/m0/s1 |
| InChIKey | JGAGCWNUIRQFEH-XFWXWYAYSA-N |
| XLogP | 2.93 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|