C21H36O3Si — CID 15726488
(3R,3aS,5S,5aS,9bR)-3,5a,9-trimethyl-5-triethylsilyloxy-3,3a,4,5,6,7,8,9b-octahydrobenzo[g][1]benzofuran-2-one (PubChem CID 15726488) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (3R,3aS,5S,5aS,9bR)-3,5a,9-trimethyl-5-triethylsilyloxy-3,3a,4,5,6,7,8,9b-octahydrobenzo[g][1]benzofuran-2-one.
| Compound Name | (3R,3aS,5S,5aS,9bR)-3,5a,9-trimethyl-5-triethylsilyloxy-3,3a,4,5,6,7,8,9b-octahydrobenzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 15726488 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (3R,3aS,5S,5aS,9bR)-3,5a,9-trimethyl-5-triethylsilyloxy-3,3a,4,5,6,7,8,9b-octahydrobenzo[g][1]benzofuran-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H]2[C@@H](C)C(=O)O[C@H]2C2=C(C)CCC[C@@]21C |
| InChI | InChI=1S/C21H36O3Si/c1-7-25(8-2,9-3)24-17-13-16-15(5)20(22)23-19(16)18-14(4)11-10-12-21(17,18)6/h15-17,19H,7-13H2,1-6H3/t15-,16+,17+,19-,21-/m1/s1 |
| InChIKey | GPPWCZLSVXURMF-BFDCFGGLSA-N |
| XLogP | 5.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|