C20H34O2 — CID 15726505
(E,3R)-6-[(1S,3R,4R)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-2-methylhept-5-ene-2,3-diol (PubChem CID 15726505) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (E,3R)-6-[(1S,3R,4R)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-2-methylhept-5-ene-2,3-diol.
| Compound Name | (E,3R)-6-[(1S,3R,4R)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-2-methylhept-5-ene-2,3-diol |
|---|---|
| PubChem CID | 15726505 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (E,3R)-6-[(1S,3R,4R)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-2-methylhept-5-ene-2,3-diol |
| SMILES | C=C[C@@]1(C)CC[C@H](/C(C)=C/C[C@@H](O)C(C)(C)O)C[C@@H]1C(=C)C |
| InChI | InChI=1S/C20H34O2/c1-8-20(7)12-11-16(13-17(20)14(2)3)15(4)9-10-18(21)19(5,6)22/h8-9,16-18,21-22H,1-2,10-13H2,3-7H3/b15-9+/t16-,17+,18+,20-/m0/s1 |
| InChIKey | CFHHZCDUEIUCET-JZXJGBJOSA-N |
| XLogP | 4.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|