C23H27Cl2N3O5S — CID 157266037
1-(2,6-dichlorophenyl)-2-[(3R)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-(hydroxymethyl)-2,3-dihydropyrido[2,3-b][1,4]oxazin-7-yl]ethanone (PubChem CID 157266037) has the molecular formula C23H27Cl2N3O5S and a molecular weight of 528.46 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-2-[(3R)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-(hydroxymethyl)-2,3-dihydropyrido[2,3-b][1,4]oxazin-7-yl]ethanone.
| Compound Name | 1-(2,6-dichlorophenyl)-2-[(3R)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-(hydroxymethyl)-2,3-dihydropyrido[2,3-b][1,4]oxazin-7-yl]ethanone |
|---|---|
| PubChem CID | 157266037 |
| Molecular Formula | C23H27Cl2N3O5S |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-2-[(3R)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-(hydroxymethyl)-2,3-dihydropyrido[2,3-b][1,4]oxazin-7-yl]ethanone |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)N2C[C@H](CO)Oc3ncc(CC(=O)c4c(Cl)cccc4Cl)cc32)C1 |
| InChI | InChI=1S/C23H27Cl2N3O5S/c1-14-6-15(2)11-27(10-14)34(31,32)28-12-17(13-29)33-23-20(28)7-16(9-26-23)8-21(30)22-18(24)4-3-5-19(22)25/h3-5,7,9,14-15,17,29H,6,8,10-13H2,1-2H3/t14-,15+,17-/m1/s1 |
| InChIKey | AXZVFMKGFGYWDL-HLLBOEOZSA-N |
| XLogP | 3.60 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |