C22H35N9O3 — CID 157266543
2-[4-[di(propan-2-yl)amino]butyl]-5-N,5-N-bis(1H-imidazol-2-ylmethyl)-3H-1,3,4-oxadiazole-2,5-dicarboxamide (PubChem CID 157266543) has the molecular formula C22H35N9O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-[4-[di(propan-2-yl)amino]butyl]-5-N,5-N-bis(1H-imidazol-2-ylmethyl)-3H-1,3,4-oxadiazole-2,5-dicarboxamide.
| Compound Name | 2-[4-[di(propan-2-yl)amino]butyl]-5-N,5-N-bis(1H-imidazol-2-ylmethyl)-3H-1,3,4-oxadiazole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 157266543 |
| Molecular Formula | C22H35N9O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 2-[4-[di(propan-2-yl)amino]butyl]-5-N,5-N-bis(1H-imidazol-2-ylmethyl)-3H-1,3,4-oxadiazole-2,5-dicarboxamide |
| SMILES | CC(C)N(CCCCC1(C(N)=O)NN=C(C(=O)N(Cc2ncc[nH]2)Cc2ncc[nH]2)O1)C(C)C |
| InChI | InChI=1S/C22H35N9O3/c1-15(2)31(16(3)4)12-6-5-7-22(21(23)33)29-28-19(34-22)20(32)30(13-17-24-8-9-25-17)14-18-26-10-11-27-18/h8-11,15-16,29H,5-7,12-14H2,1-4H3,(H2,23,33)(H,24,25)(H,26,27) |
| InChIKey | AYBGDPHTSFZMSS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|