About 3-methyl-4H-imidazo[1,2-a]indol-3-ium
3-methyl-4H-imidazo[1,2-a]indol-3-ium (PubChem CID 157267429) has the molecular formula C11H11N2+
and a molecular weight of 171.22 g/mol. Its IUPAC name is 3-methyl-4H-imidazo[1,2-a]indol-3-ium.
Molecular Properties
| Compound Name | 3-methyl-4H-imidazo[1,2-a]indol-3-ium |
| PubChem CID | 157267429 |
| Molecular Formula | C11H11N2+ |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 3-methyl-4H-imidazo[1,2-a]indol-3-ium |
| SMILES | C[n+]1ccn2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C11H11N2/c1-12-6-7-13-10-5-3-2-4-9(10)8-11(12)13/h2-7H,8H2,1H3/q+1 |
| InChIKey | OWZUPUJEXRSPGC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4H-imidazo[1,2-a]indol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4H-imidazo[1,2-a]indol-3-ium?
The IUPAC name of 3-methyl-4H-imidazo[1,2-a]indol-3-ium (CID 157267429) is 3-methyl-4H-imidazo[1,2-a]indol-3-ium.
What is the SMILES notation for 3-methyl-4H-imidazo[1,2-a]indol-3-ium?
The canonical SMILES for 3-methyl-4H-imidazo[1,2-a]indol-3-ium is C[n+]1ccn2c1Cc1ccccc1-2.
What is the InChIKey of 3-methyl-4H-imidazo[1,2-a]indol-3-ium?
The InChIKey is OWZUPUJEXRSPGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N2/c1-12-6-7-13-10-5-3-2-4-9(10)8-11(12)13/h2-7H,8H2,1H3/q+1.
What are the key properties of 3-methyl-4H-imidazo[1,2-a]indol-3-ium?
3-methyl-4H-imidazo[1,2-a]indol-3-ium has a molecular weight of 171.22 g/mol, XLogP of 1.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4H-imidazo[1,2-a]indol-3-ium is sourced from PubChem (CID 157267429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).