C18H34OSi — CID 15726787
(1S,4R,4aS,6R,8aR)-4,8a-dimethyl-6-prop-1-en-2-yl-1-trimethylsilyl-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-ol (PubChem CID 15726787) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is (1S,4R,4aS,6R,8aR)-4,8a-dimethyl-6-prop-1-en-2-yl-1-trimethylsilyl-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-ol.
| Compound Name | (1S,4R,4aS,6R,8aR)-4,8a-dimethyl-6-prop-1-en-2-yl-1-trimethylsilyl-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-ol |
|---|---|
| PubChem CID | 15726787 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | (1S,4R,4aS,6R,8aR)-4,8a-dimethyl-6-prop-1-en-2-yl-1-trimethylsilyl-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-ol |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)[C@@H]([Si](C)(C)C)CC[C@@H](C)[C@@]2(O)C1 |
| InChI | InChI=1S/C18H34OSi/c1-13(2)15-10-11-17(4)16(20(5,6)7)9-8-14(3)18(17,19)12-15/h14-16,19H,1,8-12H2,2-7H3/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | CGGNXLSZXABNDS-ZBRFXRBCSA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|