C33H20F6N8O3 — CID 157267899
8-nitro-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridine;N-[2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl]pyrimidine-2-carboxamide (PubChem CID 157267899) has the molecular formula C33H20F6N8O3 and a molecular weight of 690.56 g/mol. Its IUPAC name is 8-nitro-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridine;N-[2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl]pyrimidine-2-carboxamide.
| Compound Name | 8-nitro-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridine;N-[2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 157267899 |
| Molecular Formula | C33H20F6N8O3 |
| Molecular Weight | 690.56 g/mol |
| Exact Mass | 690.16 |
| IUPAC Name | 8-nitro-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridine;N-[2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1cccn2cc(-c3cccc(C(F)(F)F)c3)nc12)c1ncccn1.O=[N+]([O-])c1cccn2cc(-c3cccc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C19H12F3N5O.C14H8F3N3O2/c20-19(21,22)13-5-1-4-12(10-13)15-11-27-9-2-6-14(17(27)25-15)26-18(28)16-23-7-3-8-24-16;15-14(16,17)10-4-1-3-9(7-10)11-8-19-6-2-5-12(20(21)22)13(19)18-11/h1-11H,(H,26,28);1-8H |
| InChIKey | AYEXHAFVCUOMDM-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 132.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.56 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|