C17H20F6N2O4S — CID 157267922
N-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yl)piperidin-4-yl]methyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 157267922) has the molecular formula C17H20F6N2O4S and a molecular weight of 462.41 g/mol. Its IUPAC name is N-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yl)piperidin-4-yl]methyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yl)piperidin-4-yl]methyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 157267922 |
| Molecular Formula | C17H20F6N2O4S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | N-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yl)piperidin-4-yl]methyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | O=S(=O)(NCC1CCN(C(C(F)(F)F)C(F)(F)F)CC1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H20F6N2O4S/c18-16(19,20)15(17(21,22)23)25-5-3-11(4-6-25)10-24-30(26,27)12-1-2-13-14(9-12)29-8-7-28-13/h1-2,9,11,15,24H,3-8,10H2 |
| InChIKey | AYEYQEQRJLUQMG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |