C15H19NO9S — CID 15726857
tert-butyl (6R,7S)-3-(acetyloxymethyl)-7-formyloxy-5,5,8-trioxo-5lambda6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 15726857) has the molecular formula C15H19NO9S and a molecular weight of 389.38 g/mol. Its IUPAC name is tert-butyl (6R,7S)-3-(acetyloxymethyl)-7-formyloxy-5,5,8-trioxo-5lambda6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R,7S)-3-(acetyloxymethyl)-7-formyloxy-5,5,8-trioxo-5lambda6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 15726857 |
| Molecular Formula | C15H19NO9S |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | tert-butyl (6R,7S)-3-(acetyloxymethyl)-7-formyloxy-5,5,8-trioxo-5lambda6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OC(C)(C)C)N2C(=O)[C@H](OC=O)[C@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C15H19NO9S/c1-8(18)23-5-9-6-26(21,22)13-11(24-7-17)12(19)16(13)10(9)14(20)25-15(2,3)4/h7,11,13H,5-6H2,1-4H3/t11-,13+/m0/s1 |
| InChIKey | DEYBDQMVEJEJKS-WCQYABFASA-N |
| XLogP | -0.72 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|