C30H54O3Si — CID 157269136
tert-butyl-[(Z,3S)-2,2-dimethyloct-5-en-3-yl]oxy-dimethylsilane;(4S,5E)-5-ethylidene-4-[(Z)-7-hydroxyhept-2-enyl]cyclopent-2-en-1-one (PubChem CID 157269136) has the molecular formula C30H54O3Si and a molecular weight of 490.85 g/mol. Its IUPAC name is tert-butyl-[(Z,3S)-2,2-dimethyloct-5-en-3-yl]oxy-dimethylsilane;(4S,5E)-5-ethylidene-4-[(Z)-7-hydroxyhept-2-enyl]cyclopent-2-en-1-one.
| Compound Name | tert-butyl-[(Z,3S)-2,2-dimethyloct-5-en-3-yl]oxy-dimethylsilane;(4S,5E)-5-ethylidene-4-[(Z)-7-hydroxyhept-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 157269136 |
| Molecular Formula | C30H54O3Si |
| Molecular Weight | 490.85 g/mol |
| Exact Mass | 490.38 |
| IUPAC Name | tert-butyl-[(Z,3S)-2,2-dimethyloct-5-en-3-yl]oxy-dimethylsilane;(4S,5E)-5-ethylidene-4-[(Z)-7-hydroxyhept-2-enyl]cyclopent-2-en-1-one |
| SMILES | C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCCO.CC/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H34OSi.C14H20O2/c1-10-11-12-13-14(15(2,3)4)17-18(8,9)16(5,6)7;1-2-13-12(9-10-14(13)16)8-6-4-3-5-7-11-15/h11-12,14H,10,13H2,1-9H3;2,4,6,9-10,12,15H,3,5,7-8,11H2,1H3/b12-11-;6-4-,13-2+/t14-;12-/m00/s1 |
| InChIKey | AYIHXQAQUVSVQW-TZQBKOJSSA-N |
| XLogP | 8.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.85 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|