C29H32N2O — CID 157269694
(1S,2R)-1,2-dideuterio-10-(2-phenylindol-1-yl)-1-pyridin-3-yldecan-3-one (PubChem CID 157269694) has the molecular formula C29H32N2O and a molecular weight of 426.60 g/mol. Its IUPAC name is (1S,2R)-1,2-dideuterio-10-(2-phenylindol-1-yl)-1-pyridin-3-yldecan-3-one.
| Compound Name | (1S,2R)-1,2-dideuterio-10-(2-phenylindol-1-yl)-1-pyridin-3-yldecan-3-one |
|---|---|
| PubChem CID | 157269694 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (1S,2R)-1,2-dideuterio-10-(2-phenylindol-1-yl)-1-pyridin-3-yldecan-3-one |
| SMILES | [2H][C@H](c1cccnc1)[C@@H]([2H])C(=O)CCCCCCCn1c(-c2ccccc2)cc2ccccc21 |
| InChI | InChI=1S/C29H32N2O/c32-27(19-18-24-12-11-20-30-23-24)16-7-2-1-3-10-21-31-28-17-9-8-15-26(28)22-29(31)25-13-5-4-6-14-25/h4-6,8-9,11-15,17,20,22-23H,1-3,7,10,16,18-19,21H2/i18D,19D/t18-,19+/m0/s1 |
| InChIKey | AYJWQMUBVWYTSX-HJAJIKKWSA-N |
| XLogP | 7.25 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|