About 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate
3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate (PubChem CID 157269931) has the molecular formula C14H18N2O4
and a molecular weight of 278.31 g/mol. Its IUPAC name is 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate |
| PubChem CID | 157269931 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(C)c[nH]1.Cc1c[nH]c(C(=O)O)c1C |
| InChI | InChI=1S/2C7H9NO2/c1-5-3-6(8-4-5)7(9)10-2;1-4-3-8-6(5(4)2)7(9)10/h3-4,8H,1-2H3;3,8H,1-2H3,(H,9,10) |
| InChIKey | AYKMTQWWDRIVMQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate?
The IUPAC name of 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate (CID 157269931) is 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate.
What is the SMILES notation for 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate?
The canonical SMILES for 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate is COC(=O)c1cc(C)c[nH]1.Cc1c[nH]c(C(=O)O)c1C.
What is the InChIKey of 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate?
The InChIKey is AYKMTQWWDRIVMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H9NO2/c1-5-3-6(8-4-5)7(9)10-2;1-4-3-8-6(5(4)2)7(9)10/h3-4,8H,1-2H3;3,8H,1-2H3,(H,9,10).
What are the key properties of 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate?
3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate has a molecular weight of 278.31 g/mol, XLogP of 2.44, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1H-pyrrole-2-carboxylic acid;methyl 4-methyl-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 157269931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).