C18H14FN3O2 — CID 157270549
2-(5-fluoro-2-pyridinyl)-1-(6-methyl-4-pyridin-3-yloxy-2-pyridinyl)ethanone (PubChem CID 157270549) has the molecular formula C18H14FN3O2 and a molecular weight of 323.33 g/mol. Its IUPAC name is 2-(5-fluoro-2-pyridinyl)-1-(6-methyl-4-pyridin-3-yloxy-2-pyridinyl)ethanone.
| Compound Name | 2-(5-fluoro-2-pyridinyl)-1-(6-methyl-4-pyridin-3-yloxy-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 157270549 |
| Molecular Formula | C18H14FN3O2 |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-(5-fluoro-2-pyridinyl)-1-(6-methyl-4-pyridin-3-yloxy-2-pyridinyl)ethanone |
| SMILES | Cc1cc(Oc2cccnc2)cc(C(=O)Cc2ccc(F)cn2)n1 |
| InChI | InChI=1S/C18H14FN3O2/c1-12-7-16(24-15-3-2-6-20-11-15)9-17(22-12)18(23)8-14-5-4-13(19)10-21-14/h2-7,9-11H,8H2,1H3 |
| InChIKey | AYMHFWWBNQPNNL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |