C14H18O3 — CID 15727108
(2R)-2-[(2S,4E,6E)-2-methyl-3-oxoocta-4,6-dienyl]-2H-pyran-5-one (PubChem CID 15727108) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (2R)-2-[(2S,4E,6E)-2-methyl-3-oxoocta-4,6-dienyl]-2H-pyran-5-one.
| Compound Name | (2R)-2-[(2S,4E,6E)-2-methyl-3-oxoocta-4,6-dienyl]-2H-pyran-5-one |
|---|---|
| PubChem CID | 15727108 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2R)-2-[(2S,4E,6E)-2-methyl-3-oxoocta-4,6-dienyl]-2H-pyran-5-one |
| SMILES | C/C=C/C=C/C(=O)[C@@H](C)C[C@@H]1C=CC(=O)CO1 |
| InChI | InChI=1S/C14H18O3/c1-3-4-5-6-14(16)11(2)9-13-8-7-12(15)10-17-13/h3-8,11,13H,9-10H2,1-2H3/b4-3+,6-5+/t11-,13-/m0/s1 |
| InChIKey | IAHJROQSGDNMBX-PHUNHAGDSA-N |
| XLogP | 2.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|