C15H27NO2 — CID 15727157
[(3E)-6-methylhepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 15727157) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is [(3E)-6-methylhepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(3E)-6-methylhepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 15727157 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | [(3E)-6-methylhepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | C=C/C(=C\CC(C)C)OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H27NO2/c1-8-14(10-9-11(2)3)18-15(17)16(12(4)5)13(6)7/h8,10-13H,1,9H2,2-7H3/b14-10+ |
| InChIKey | GIMZGIVSLXUTBX-GXDHUFHOSA-N |
| XLogP | 4.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|