C31H36Cl3N7O6S2 — CID 157271652
2-[4-chloro-7-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]isoquinolin-1-yl]guanidine;1,4-dichloro-N-[1-(hydroxymethyl)cyclopentyl]isoquinoline-7-sulfonamide (PubChem CID 157271652) has the molecular formula C31H36Cl3N7O6S2 and a molecular weight of 773.17 g/mol. Its IUPAC name is 2-[4-chloro-7-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]isoquinolin-1-yl]guanidine;1,4-dichloro-N-[1-(hydroxymethyl)cyclopentyl]isoquinoline-7-sulfonamide.
| Compound Name | 2-[4-chloro-7-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]isoquinolin-1-yl]guanidine;1,4-dichloro-N-[1-(hydroxymethyl)cyclopentyl]isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 157271652 |
| Molecular Formula | C31H36Cl3N7O6S2 |
| Molecular Weight | 773.17 g/mol |
| Exact Mass | 771.12 |
| IUPAC Name | 2-[4-chloro-7-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]isoquinolin-1-yl]guanidine;1,4-dichloro-N-[1-(hydroxymethyl)cyclopentyl]isoquinoline-7-sulfonamide |
| SMILES | NC(N)=Nc1ncc(Cl)c2ccc(S(=O)(=O)NC3(CO)CCCC3)cc12.O=S(=O)(NC1(CO)CCCC1)c1ccc2c(Cl)cnc(Cl)c2c1 |
| InChI | InChI=1S/C16H20ClN5O3S.C15H16Cl2N2O3S/c17-13-8-20-14(21-15(18)19)12-7-10(3-4-11(12)13)26(24,25)22-16(9-23)5-1-2-6-16;16-13-8-18-14(17)12-7-10(3-4-11(12)13)23(21,22)19-15(9-20)5-1-2-6-15/h3-4,7-8,22-23H,1-2,5-6,9H2,(H4,18,19,20,21);3-4,7-8,19-20H,1-2,5-6,9H2 |
| InChIKey | AYPMSEDVOQEKQB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 222.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.17 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|