C23H29F3N2O3 — CID 157272650
(4aR,8aS)-6-[4-[[4-(trifluoromethyl)phenyl]methyl]azepane-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 157272650) has the molecular formula C23H29F3N2O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-[[4-(trifluoromethyl)phenyl]methyl]azepane-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[4-[[4-(trifluoromethyl)phenyl]methyl]azepane-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 157272650 |
| Molecular Formula | C23H29F3N2O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (4aR,8aS)-6-[4-[[4-(trifluoromethyl)phenyl]methyl]azepane-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CCCC(Cc4ccc(C(F)(F)F)cc4)CC3)C[C@H]2C1 |
| InChI | InChI=1S/C23H29F3N2O3/c24-23(25,26)19-5-3-17(4-6-19)12-16-2-1-9-27(10-7-16)22(30)28-11-8-21-18(14-28)13-20(29)15-31-21/h3-6,16,18,21H,1-2,7-15H2/t16?,18-,21+/m1/s1 |
| InChIKey | AYSJJJOKSSHXBV-OHIWNTBFSA-N |
| XLogP | 4.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |