About N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane
N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane (PubChem CID 157273277) has the molecular formula C6H19F2N3O
and a molecular weight of 187.23 g/mol. Its IUPAC name is N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane.
Molecular Properties
| Compound Name | N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane |
| PubChem CID | 157273277 |
| Molecular Formula | C6H19F2N3O |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane |
| SMILES | C.C.C=C(N)CF.NC(F)NO |
| InChI | InChI=1S/C3H6FN.CH5FN2O.2CH4/c1-3(5)2-4;2-1(3)4-5;;/h1-2,5H2;1,4-5H,3H2;2*1H4 |
| InChIKey | AYUDANZMXMBOOQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane?
The IUPAC name of N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane (CID 157273277) is N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane.
What is the SMILES notation for N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane?
The canonical SMILES for N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane is C.C.C=C(N)CF.NC(F)NO.
What is the InChIKey of N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane?
The InChIKey is AYUDANZMXMBOOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6FN.CH5FN2O.2CH4/c1-3(5)2-4;2-1(3)4-5;;/h1-2,5H2;1,4-5H,3H2;2*1H4.
What are the key properties of N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane?
N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane has a molecular weight of 187.23 g/mol, XLogP of 0.88, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[amino(fluoro)methyl]hydroxylamine;3-fluoroprop-1-en-2-amine;methane is sourced from PubChem (CID 157273277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).