About methane;S-methyl N-methylcarbamothioate
methane;S-methyl N-methylcarbamothioate (PubChem CID 157274108) has the molecular formula C4H11NOS
and a molecular weight of 121.20 g/mol. Its IUPAC name is methane;S-methyl N-methylcarbamothioate.
Molecular Properties
| Compound Name | methane;S-methyl N-methylcarbamothioate |
| PubChem CID | 157274108 |
| Molecular Formula | C4H11NOS |
| Molecular Weight | 121.20 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | methane;S-methyl N-methylcarbamothioate |
| SMILES | C.CNC(=O)SC |
| InChI | InChI=1S/C3H7NOS.CH4/c1-4-3(5)6-2;/h1-2H3,(H,4,5);1H4 |
| InChIKey | AYWPRJLBPJUHTH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methane;S-methyl N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;S-methyl N-methylcarbamothioate?
The IUPAC name of methane;S-methyl N-methylcarbamothioate (CID 157274108) is methane;S-methyl N-methylcarbamothioate.
What is the SMILES notation for methane;S-methyl N-methylcarbamothioate?
The canonical SMILES for methane;S-methyl N-methylcarbamothioate is C.CNC(=O)SC.
What is the InChIKey of methane;S-methyl N-methylcarbamothioate?
The InChIKey is AYWPRJLBPJUHTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NOS.CH4/c1-4-3(5)6-2;/h1-2H3,(H,4,5);1H4.
What are the key properties of methane;S-methyl N-methylcarbamothioate?
methane;S-methyl N-methylcarbamothioate has a molecular weight of 121.20 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;S-methyl N-methylcarbamothioate is sourced from PubChem (CID 157274108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).