C11H10F3N3O3 — CID 157275207
3,5-dioxo-N-(2,2,2-trifluoroethyl)-2,6,7,8-tetrahydro-2,6-naphthyridine-1-carboxamide (PubChem CID 157275207) has the molecular formula C11H10F3N3O3 and a molecular weight of 289.21 g/mol. Its IUPAC name is 3,5-dioxo-N-(2,2,2-trifluoroethyl)-2,6,7,8-tetrahydro-2,6-naphthyridine-1-carboxamide.
| Compound Name | 3,5-dioxo-N-(2,2,2-trifluoroethyl)-2,6,7,8-tetrahydro-2,6-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 157275207 |
| Molecular Formula | C11H10F3N3O3 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3,5-dioxo-N-(2,2,2-trifluoroethyl)-2,6,7,8-tetrahydro-2,6-naphthyridine-1-carboxamide |
| SMILES | O=C1NCCc2c1cc(=O)[nH]c2C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H10F3N3O3/c12-11(13,14)4-16-10(20)8-5-1-2-15-9(19)6(5)3-7(18)17-8/h3H,1-2,4H2,(H,15,19)(H,16,20)(H,17,18) |
| InChIKey | AZAAHNAXTLLHJJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |