About 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol
1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol (PubChem CID 157275503) has the molecular formula C20H23BrO2
and a molecular weight of 375.31 g/mol. Its IUPAC name is 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol |
| PubChem CID | 157275503 |
| Molecular Formula | C20H23BrO2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol |
| SMILES | C#CCO.C=C(CO)c1ccc(C)cc1.Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H12O.C7H7Br.C3H4O/c1-8-3-5-10(6-4-8)9(2)7-11;1-6-2-4-7(8)5-3-6;1-2-3-4/h3-6,11H,2,7H2,1H3;2-5H,1H3;1,4H,3H2 |
| InChIKey | AZAWQALRZYGHCL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol?
The IUPAC name of 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol (CID 157275503) is 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol.
What is the SMILES notation for 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol?
The canonical SMILES for 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol is C#CCO.C=C(CO)c1ccc(C)cc1.Cc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol?
The InChIKey is AZAWQALRZYGHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C7H7Br.C3H4O/c1-8-3-5-10(6-4-8)9(2)7-11;1-6-2-4-7(8)5-3-6;1-2-3-4/h3-6,11H,2,7H2,1H3;2-5H,1H3;1,4H,3H2.
What are the key properties of 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol?
1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol has a molecular weight of 375.31 g/mol, XLogP of 4.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methylbenzene;2-(4-methylphenyl)prop-2-en-1-ol;prop-2-yn-1-ol is sourced from PubChem (CID 157275503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).