C25H35N3O5 — CID 157276371
3-(2-aminoethyl)-N'-tert-butyl-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide;3,5-dimethylbenzoic acid (PubChem CID 157276371) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-(2-aminoethyl)-N'-tert-butyl-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide;3,5-dimethylbenzoic acid.
| Compound Name | 3-(2-aminoethyl)-N'-tert-butyl-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide;3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 157276371 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 3-(2-aminoethyl)-N'-tert-butyl-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide;3,5-dimethylbenzoic acid |
| SMILES | Cc1c(C(=O)NNC(C)(C)C)ccc2c1OC(CCN)CO2.Cc1cc(C)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H25N3O3.C9H10O2/c1-10-12(15(20)18-19-16(2,3)4)5-6-13-14(10)22-11(7-8-17)9-21-13;1-6-3-7(2)5-8(4-6)9(10)11/h5-6,11,19H,7-9,17H2,1-4H3,(H,18,20);3-5H,1-2H3,(H,10,11) |
| InChIKey | AZDNMIBKPTWUAM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|