C46H59BrN8O4Sn — CID 157276866
5-bromo-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole;1-methyl-3-(2-methyl-4-pyridinyl)-6-nitro-5-prop-2-enylindazole;tributyl(prop-2-enyl)stannane (PubChem CID 157276866) has the molecular formula C46H59BrN8O4Sn and a molecular weight of 986.64 g/mol. Its IUPAC name is 5-bromo-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole;1-methyl-3-(2-methyl-4-pyridinyl)-6-nitro-5-prop-2-enylindazole;tributyl(prop-2-enyl)stannane.
| Compound Name | 5-bromo-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole;1-methyl-3-(2-methyl-4-pyridinyl)-6-nitro-5-prop-2-enylindazole;tributyl(prop-2-enyl)stannane |
|---|---|
| PubChem CID | 157276866 |
| Molecular Formula | C46H59BrN8O4Sn |
| Molecular Weight | 986.64 g/mol |
| Exact Mass | 986.29 |
| IUPAC Name | 5-bromo-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole;1-methyl-3-(2-methyl-4-pyridinyl)-6-nitro-5-prop-2-enylindazole;tributyl(prop-2-enyl)stannane |
| SMILES | C=CC[Sn](CCCC)(CCCC)CCCC.C=CCc1cc2c(-c3ccnc(C)c3)nn(C)c2cc1[N+](=O)[O-].Cc1cc(-c2nn(C)c3cc([N+](=O)[O-])c(Br)cc23)ccn1 |
| InChI | InChI=1S/C17H16N4O2.C14H11BrN4O2.3C4H9.C3H5.Sn/c1-4-5-12-9-14-16(10-15(12)21(22)23)20(3)19-17(14)13-6-7-18-11(2)8-13;1-8-5-9(3-4-16-8)14-10-6-11(15)13(19(20)21)7-12(10)18(2)17-14;3*1-3-4-2;1-3-2;/h4,6-10H,1,5H2,2-3H3;3-7H,1-2H3;3*1,3-4H2,2H3;3H,1-2H2; |
| InChIKey | AZFBAVBUDHSQTM-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 147.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.64 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|