C23H26Cl2F4N2O2S2 — CID 157277028
2-[3-(2,3,5,6-tetrafluoro-4-methylphenyl)propyldisulfanyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate (PubChem CID 157277028) has the molecular formula C23H26Cl2F4N2O2S2 and a molecular weight of 573.51 g/mol. Its IUPAC name is 2-[3-(2,3,5,6-tetrafluoro-4-methylphenyl)propyldisulfanyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate.
| Compound Name | 2-[3-(2,3,5,6-tetrafluoro-4-methylphenyl)propyldisulfanyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 157277028 |
| Molecular Formula | C23H26Cl2F4N2O2S2 |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 2-[3-(2,3,5,6-tetrafluoro-4-methylphenyl)propyldisulfanyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate |
| SMILES | Cc1c(F)c(F)c(CCCSSCCOC(=O)Nc2ccc(N(CCCl)CCCl)cc2)c(F)c1F |
| InChI | InChI=1S/C23H26Cl2F4N2O2S2/c1-15-19(26)21(28)18(22(29)20(15)27)3-2-13-34-35-14-12-33-23(32)30-16-4-6-17(7-5-16)31(10-8-24)11-9-25/h4-7H,2-3,8-14H2,1H3,(H,30,32) |
| InChIKey | PXCBPSNFOXJMLJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|